C26H42O9Si — CID 59061000
1-O-tert-butyl 5-O-(5-oxooxolan-3-yl) 4-methyl-2-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate (PubChem CID 59061000) has the molecular formula C26H42O9Si and a molecular weight of 526.70 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(5-oxooxolan-3-yl) 4-methyl-2-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(5-oxooxolan-3-yl) 4-methyl-2-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate |
|---|---|
| PubChem CID | 59061000 |
| Molecular Formula | C26H42O9Si |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 1-O-tert-butyl 5-O-(5-oxooxolan-3-yl) 4-methyl-2-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate |
| SMILES | CC(CC1C(=O)OC(=O)C1CC(CC(C)C(=O)OC1COC(=O)C1)C(=O)OC(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C26H42O9Si/c1-15(14-36(6,7)8)9-19-20(25(31)34-24(19)30)11-17(23(29)35-26(3,4)5)10-16(2)22(28)33-18-12-21(27)32-13-18/h15-20H,9-14H2,1-8H3 |
| InChIKey | NLWXUKNNIRKGTI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|