C23H36O6 — CID 66827213
2-O-butyl 3-O-(5-oxooxolan-3-yl) 5,6-di(propan-2-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 66827213) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-O-butyl 3-O-(5-oxooxolan-3-yl) 5,6-di(propan-2-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | 2-O-butyl 3-O-(5-oxooxolan-3-yl) 5,6-di(propan-2-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 66827213 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-O-butyl 3-O-(5-oxooxolan-3-yl) 5,6-di(propan-2-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCCCOC(=O)C1C2CC(C1C(=O)OC1COC(=O)C1)C(C(C)C)C2C(C)C |
| InChI | InChI=1S/C23H36O6/c1-6-7-8-27-22(25)20-15-10-16(19(13(4)5)18(15)12(2)3)21(20)23(26)29-14-9-17(24)28-11-14/h12-16,18-21H,6-11H2,1-5H3 |
| InChIKey | XUJZMYFXTIBHRS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|