C25H42Br2O4 — CID 142727753
dioctyl 5,6-dibromobicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 142727753) has the molecular formula C25H42Br2O4 and a molecular weight of 566.42 g/mol. Its IUPAC name is dioctyl 5,6-dibromobicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | dioctyl 5,6-dibromobicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142727753 |
| Molecular Formula | C25H42Br2O4 |
| Molecular Weight | 566.42 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | dioctyl 5,6-dibromobicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)C1C2CC(C(Br)C2Br)C1C(=O)OCCCCCCCC |
| InChI | InChI=1S/C25H42Br2O4/c1-3-5-7-9-11-13-15-30-24(28)20-18-17-19(23(27)22(18)26)21(20)25(29)31-16-14-12-10-8-6-4-2/h18-23H,3-17H2,1-2H3 |
| InChIKey | BTMFFLYNXFNSMR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.42 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|