C24H36O8 — CID 144516052
dioctyl 2,5-dioxo-3,6-dihydrofuro[3,2-b]furan-3,6-dicarboxylate (PubChem CID 144516052) has the molecular formula C24H36O8 and a molecular weight of 452.54 g/mol. Its IUPAC name is dioctyl 2,5-dioxo-3,6-dihydrofuro[3,2-b]furan-3,6-dicarboxylate.
| Compound Name | dioctyl 2,5-dioxo-3,6-dihydrofuro[3,2-b]furan-3,6-dicarboxylate |
|---|---|
| PubChem CID | 144516052 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | dioctyl 2,5-dioxo-3,6-dihydrofuro[3,2-b]furan-3,6-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)C1C(=O)OC2=C1OC(=O)C2C(=O)OCCCCCCCC |
| InChI | InChI=1S/C24H36O8/c1-3-5-7-9-11-13-15-29-21(25)17-19-20(32-23(17)27)18(24(28)31-19)22(26)30-16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | BZKSRAPENYKYNI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|