C28H42O10 — CID 123460966
3-(2,2-dimethylbutanoyloxy)propyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate;(5-oxooxolan-3-yl) 2,2-dimethylbutanoate (PubChem CID 123460966) has the molecular formula C28H42O10 and a molecular weight of 538.63 g/mol. Its IUPAC name is 3-(2,2-dimethylbutanoyloxy)propyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate;(5-oxooxolan-3-yl) 2,2-dimethylbutanoate.
| Compound Name | 3-(2,2-dimethylbutanoyloxy)propyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate;(5-oxooxolan-3-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 123460966 |
| Molecular Formula | C28H42O10 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 3-(2,2-dimethylbutanoyloxy)propyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate;(5-oxooxolan-3-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1COC(=O)C1.CCC(C)(C)C(=O)OCCCOC(=O)C1C2CC3OC(=O)C1C3C2 |
| InChI | InChI=1S/C18H26O6.C10H16O4/c1-4-18(2,3)17(21)23-7-5-6-22-15(19)13-10-8-11-12(9-10)24-16(20)14(11)13;1-4-10(2,3)9(12)14-7-5-8(11)13-6-7/h10-14H,4-9H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | CFFQCVIEKLOCIB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|