C37H67O9P — CID 129023765
methyl-[3-(oxiran-2-ylmethyl)-4-oxo-4-[2,3,3-trimethyl-8-oxo-8-[2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]-7-(oxiran-2-ylmethyl)-8-oxooctan-2-yl]oxyoctan-2-yl]oxybutyl]phosphinous acid (PubChem CID 129023765) has the molecular formula C37H67O9P and a molecular weight of 686.91 g/mol. Its IUPAC name is methyl-[3-(oxiran-2-ylmethyl)-4-oxo-4-[2,3,3-trimethyl-8-oxo-8-[2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]-7-(oxiran-2-ylmethyl)-8-oxooctan-2-yl]oxyoctan-2-yl]oxybutyl]phosphinous acid.
| Compound Name | methyl-[3-(oxiran-2-ylmethyl)-4-oxo-4-[2,3,3-trimethyl-8-oxo-8-[2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]-7-(oxiran-2-ylmethyl)-8-oxooctan-2-yl]oxyoctan-2-yl]oxybutyl]phosphinous acid |
|---|---|
| PubChem CID | 129023765 |
| Molecular Formula | C37H67O9P |
| Molecular Weight | 686.91 g/mol |
| Exact Mass | 686.45 |
| IUPAC Name | methyl-[3-(oxiran-2-ylmethyl)-4-oxo-4-[2,3,3-trimethyl-8-oxo-8-[2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]-7-(oxiran-2-ylmethyl)-8-oxooctan-2-yl]oxyoctan-2-yl]oxybutyl]phosphinous acid |
| SMILES | CP(O)CCC(CC1CO1)C(=O)OC(C)(C)C(C)(C)CCCCC(=O)OC(C)(C)C(C)(C)CCCC(CC1CO1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H67O9P/c1-33(2,3)45-31(39)26(22-28-24-42-28)16-15-20-35(6,7)36(8,9)44-30(38)17-13-14-19-34(4,5)37(10,11)46-32(40)27(18-21-47(12)41)23-29-25-43-29/h26-29,41H,13-25H2,1-12H3 |
| InChIKey | BOVQCRAFQNAJGR-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.91 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|