About tert-butyl 9-(oxiran-2-yl)nonanoate
tert-butyl 9-(oxiran-2-yl)nonanoate (PubChem CID 121288864) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is tert-butyl 9-(oxiran-2-yl)nonanoate.
Molecular Properties
| Compound Name | tert-butyl 9-(oxiran-2-yl)nonanoate |
| PubChem CID | 121288864 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | tert-butyl 9-(oxiran-2-yl)nonanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCCCC1CO1 |
| InChI | InChI=1S/C15H28O3/c1-15(2,3)18-14(16)11-9-7-5-4-6-8-10-13-12-17-13/h13H,4-12H2,1-3H3 |
| InChIKey | KQBXAKTYQNZZIX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 9-(oxiran-2-yl)nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 9-(oxiran-2-yl)nonanoate?
The IUPAC name of tert-butyl 9-(oxiran-2-yl)nonanoate (CID 121288864) is tert-butyl 9-(oxiran-2-yl)nonanoate.
What is the SMILES notation for tert-butyl 9-(oxiran-2-yl)nonanoate?
The canonical SMILES for tert-butyl 9-(oxiran-2-yl)nonanoate is CC(C)(C)OC(=O)CCCCCCCCC1CO1.
What is the InChIKey of tert-butyl 9-(oxiran-2-yl)nonanoate?
The InChIKey is KQBXAKTYQNZZIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-15(2,3)18-14(16)11-9-7-5-4-6-8-10-13-12-17-13/h13H,4-12H2,1-3H3.
What are the key properties of tert-butyl 9-(oxiran-2-yl)nonanoate?
tert-butyl 9-(oxiran-2-yl)nonanoate has a molecular weight of 256.39 g/mol, XLogP of 3.85, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 9-(oxiran-2-yl)nonanoate is sourced from PubChem (CID 121288864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).