About ditert-butyl 2-(6-oxoheptyl)propanedioate
ditert-butyl 2-(6-oxoheptyl)propanedioate (PubChem CID 58794714) has the molecular formula C18H32O5
and a molecular weight of 328.45 g/mol. Its IUPAC name is ditert-butyl 2-(6-oxoheptyl)propanedioate.
Molecular Properties
| Compound Name | ditert-butyl 2-(6-oxoheptyl)propanedioate |
| PubChem CID | 58794714 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | ditert-butyl 2-(6-oxoheptyl)propanedioate |
| SMILES | CC(=O)CCCCCC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32O5/c1-13(19)11-9-8-10-12-14(15(20)22-17(2,3)4)16(21)23-18(5,6)7/h14H,8-12H2,1-7H3 |
| InChIKey | UJJXRAAYAYCKDI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 2-(6-oxoheptyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-(6-oxoheptyl)propanedioate?
The IUPAC name of ditert-butyl 2-(6-oxoheptyl)propanedioate (CID 58794714) is ditert-butyl 2-(6-oxoheptyl)propanedioate.
What is the SMILES notation for ditert-butyl 2-(6-oxoheptyl)propanedioate?
The canonical SMILES for ditert-butyl 2-(6-oxoheptyl)propanedioate is CC(=O)CCCCCC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 2-(6-oxoheptyl)propanedioate?
The InChIKey is UJJXRAAYAYCKDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O5/c1-13(19)11-9-8-10-12-14(15(20)22-17(2,3)4)16(21)23-18(5,6)7/h14H,8-12H2,1-7H3.
What are the key properties of ditert-butyl 2-(6-oxoheptyl)propanedioate?
ditert-butyl 2-(6-oxoheptyl)propanedioate has a molecular weight of 328.45 g/mol, XLogP of 3.83, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-(6-oxoheptyl)propanedioate is sourced from PubChem (CID 58794714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).