C23H42O6Si2 — CID 20754308
1,3-bis(trimethylsilyl)propan-2-yl 2,2-dimethyl-3-[4-(3-methyloxolan-2-yl)-2,5-dioxooxolan-3-yl]propanoate (PubChem CID 20754308) has the molecular formula C23H42O6Si2 and a molecular weight of 470.76 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyl)propan-2-yl 2,2-dimethyl-3-[4-(3-methyloxolan-2-yl)-2,5-dioxooxolan-3-yl]propanoate.
| Compound Name | 1,3-bis(trimethylsilyl)propan-2-yl 2,2-dimethyl-3-[4-(3-methyloxolan-2-yl)-2,5-dioxooxolan-3-yl]propanoate |
|---|---|
| PubChem CID | 20754308 |
| Molecular Formula | C23H42O6Si2 |
| Molecular Weight | 470.76 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 1,3-bis(trimethylsilyl)propan-2-yl 2,2-dimethyl-3-[4-(3-methyloxolan-2-yl)-2,5-dioxooxolan-3-yl]propanoate |
| SMILES | CC1CCOC1C1C(=O)OC(=O)C1CC(C)(C)C(=O)OC(C[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C23H42O6Si2/c1-15-10-11-27-19(15)18-17(20(24)29-21(18)25)12-23(2,3)22(26)28-16(13-30(4,5)6)14-31(7,8)9/h15-19H,10-14H2,1-9H3 |
| InChIKey | JUWMUBAOWWYNSH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.76 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|