C26H48O7Si2 — CID 20754312
1,3-bis(trimethylsilyl)propan-2-yl 3-[4-(6-ethoxy-3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate (PubChem CID 20754312) has the molecular formula C26H48O7Si2 and a molecular weight of 528.84 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyl)propan-2-yl 3-[4-(6-ethoxy-3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate.
| Compound Name | 1,3-bis(trimethylsilyl)propan-2-yl 3-[4-(6-ethoxy-3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 20754312 |
| Molecular Formula | C26H48O7Si2 |
| Molecular Weight | 528.84 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | 1,3-bis(trimethylsilyl)propan-2-yl 3-[4-(6-ethoxy-3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate |
| SMILES | CCOC1CCC(C)C(C2C(=O)OC(=O)C2CC(C)(C)C(=O)OC(C[Si](C)(C)C)C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C26H48O7Si2/c1-11-30-20-13-12-17(2)22(32-20)21-19(23(27)33-24(21)28)14-26(3,4)25(29)31-18(15-34(5,6)7)16-35(8,9)10/h17-22H,11-16H2,1-10H3 |
| InChIKey | IHBMABZDCRSVSQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.84 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|