C22H40O6Si2 — CID 123636045
1,3-bis(dimethylsilyl)propan-2-yl 2,2-dimethyl-3-[4-(3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]propanoate (PubChem CID 123636045) has the molecular formula C22H40O6Si2 and a molecular weight of 456.73 g/mol. Its IUPAC name is 1,3-bis(dimethylsilyl)propan-2-yl 2,2-dimethyl-3-[4-(3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]propanoate.
| Compound Name | 1,3-bis(dimethylsilyl)propan-2-yl 2,2-dimethyl-3-[4-(3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]propanoate |
|---|---|
| PubChem CID | 123636045 |
| Molecular Formula | C22H40O6Si2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1,3-bis(dimethylsilyl)propan-2-yl 2,2-dimethyl-3-[4-(3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]propanoate |
| SMILES | CC1CCCOC1C1C(=O)OC(=O)C1CC(C)(C)C(=O)OC(C[SiH](C)C)C[SiH](C)C |
| InChI | InChI=1S/C22H40O6Si2/c1-14-9-8-10-26-18(14)17-16(19(23)28-20(17)24)11-22(2,3)21(25)27-15(12-29(4)5)13-30(6)7/h14-18,29-30H,8-13H2,1-7H3 |
| InChIKey | VWNMOMLYMOVXLJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|