C25H44O8Si2 — CID 20822627
[3-methyl-4-[4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]butyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate (PubChem CID 20822627) has the molecular formula C25H44O8Si2 and a molecular weight of 528.79 g/mol. Its IUPAC name is [3-methyl-4-[4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]butyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate.
| Compound Name | [3-methyl-4-[4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]butyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate |
|---|---|
| PubChem CID | 20822627 |
| Molecular Formula | C25H44O8Si2 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | [3-methyl-4-[4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]butyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate |
| SMILES | CC(CCOC(=O)C1C[Si](C)(C)O[Si](C)(C)C1)CC1C(=O)OC(=O)C1CC(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H44O8Si2/c1-16(10-11-30-22(27)18-14-34(6,7)33-35(8,9)15-18)12-19-20(24(29)31-23(19)28)13-17(2)21(26)32-25(3,4)5/h16-20H,10-15H2,1-9H3 |
| InChIKey | JQKKVISQOIQSEO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|