C24H42O8Si2 — CID 20822626
[2-methyl-3-[4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]propyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate (PubChem CID 20822626) has the molecular formula C24H42O8Si2 and a molecular weight of 514.76 g/mol. Its IUPAC name is [2-methyl-3-[4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]propyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate.
| Compound Name | [2-methyl-3-[4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]propyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate |
|---|---|
| PubChem CID | 20822626 |
| Molecular Formula | C24H42O8Si2 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | [2-methyl-3-[4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]propyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate |
| SMILES | CC(COC(=O)C1C[Si](C)(C)O[Si](C)(C)C1)CC1C(=O)OC(=O)C1CC(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H42O8Si2/c1-15(12-29-21(26)17-13-33(6,7)32-34(8,9)14-17)10-18-19(23(28)30-22(18)27)11-16(2)20(25)31-24(3,4)5/h15-19H,10-14H2,1-9H3 |
| InChIKey | LORUENHZHOTACY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|