C28H50O9Si — CID 20580311
3-[2-[3-(4,4-dimethyl-2-oxooxolan-3-yl)-3-hydroperoxy-2-methylpropyl]-3-hydroperoxy-4,4-dimethylpentyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione (PubChem CID 20580311) has the molecular formula C28H50O9Si and a molecular weight of 558.79 g/mol. Its IUPAC name is 3-[2-[3-(4,4-dimethyl-2-oxooxolan-3-yl)-3-hydroperoxy-2-methylpropyl]-3-hydroperoxy-4,4-dimethylpentyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione.
| Compound Name | 3-[2-[3-(4,4-dimethyl-2-oxooxolan-3-yl)-3-hydroperoxy-2-methylpropyl]-3-hydroperoxy-4,4-dimethylpentyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 20580311 |
| Molecular Formula | C28H50O9Si |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 3-[2-[3-(4,4-dimethyl-2-oxooxolan-3-yl)-3-hydroperoxy-2-methylpropyl]-3-hydroperoxy-4,4-dimethylpentyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione |
| SMILES | CCC(C[Si](C)(C)C)C1C(=O)OC(=O)C1CC(CC(C)C(OO)C1C(=O)OCC1(C)C)C(OO)C(C)(C)C |
| InChI | InChI=1S/C28H50O9Si/c1-11-17(14-38(8,9)10)20-19(24(29)35-25(20)30)13-18(23(37-33)27(3,4)5)12-16(2)22(36-32)21-26(31)34-15-28(21,6)7/h16-23,32-33H,11-15H2,1-10H3 |
| InChIKey | NCSAYDNJJQZURT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|