C29H54O8Si2 — CID 11284736
[(1S,3S,4aS,5S,9aS)-1-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-oxo-1,3,4,5,6,7,8,9a-octahydrocyclohepta[c]pyran-3-yl] acetate (PubChem CID 11284736) has the molecular formula C29H54O8Si2 and a molecular weight of 586.92 g/mol. Its IUPAC name is [(1S,3S,4aS,5S,9aS)-1-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-oxo-1,3,4,5,6,7,8,9a-octahydrocyclohepta[c]pyran-3-yl] acetate.
| Compound Name | [(1S,3S,4aS,5S,9aS)-1-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-oxo-1,3,4,5,6,7,8,9a-octahydrocyclohepta[c]pyran-3-yl] acetate |
|---|---|
| PubChem CID | 11284736 |
| Molecular Formula | C29H54O8Si2 |
| Molecular Weight | 586.92 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | [(1S,3S,4aS,5S,9aS)-1-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-oxo-1,3,4,5,6,7,8,9a-octahydrocyclohepta[c]pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@]2(CCCO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)CCCC(=O)[C@@H]2[C@H](OC(C)=O)O1 |
| InChI | InChI=1S/C29H54O8Si2/c1-20(30)34-24-19-29(17-14-18-33-38(9,10)27(3,4)5)23(37-39(11,12)28(6,7)8)16-13-15-22(32)25(29)26(36-24)35-21(2)31/h23-26H,13-19H2,1-12H3/t23-,24+,25+,26+,29+/m0/s1 |
| InChIKey | BMJPBXYDZFODNB-JKMMNVDNSA-N |
| XLogP | 6.73 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.92 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|