C35H66O9Si — CID 10985192
[(2R,3R,4R,8S,9S,11S,12R,13S)-11-[tert-butyl(dimethyl)silyl]oxy-1-(5,5-dimethyl-1,3-dioxan-2-yl)-9,13-dimethoxy-2,4,8,12-tetramethyl-5,15-dioxopentadecan-3-yl] acetate (PubChem CID 10985192) has the molecular formula C35H66O9Si and a molecular weight of 658.99 g/mol. Its IUPAC name is [(2R,3R,4R,8S,9S,11S,12R,13S)-11-[tert-butyl(dimethyl)silyl]oxy-1-(5,5-dimethyl-1,3-dioxan-2-yl)-9,13-dimethoxy-2,4,8,12-tetramethyl-5,15-dioxopentadecan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,8S,9S,11S,12R,13S)-11-[tert-butyl(dimethyl)silyl]oxy-1-(5,5-dimethyl-1,3-dioxan-2-yl)-9,13-dimethoxy-2,4,8,12-tetramethyl-5,15-dioxopentadecan-3-yl] acetate |
|---|---|
| PubChem CID | 10985192 |
| Molecular Formula | C35H66O9Si |
| Molecular Weight | 658.99 g/mol |
| Exact Mass | 658.45 |
| IUPAC Name | [(2R,3R,4R,8S,9S,11S,12R,13S)-11-[tert-butyl(dimethyl)silyl]oxy-1-(5,5-dimethyl-1,3-dioxan-2-yl)-9,13-dimethoxy-2,4,8,12-tetramethyl-5,15-dioxopentadecan-3-yl] acetate |
| SMILES | CO[C@@H](CC=O)[C@@H](C)[C@H](C[C@H](OC)[C@@H](C)CCC(=O)[C@H](C)[C@H](OC(C)=O)[C@H](C)CC1OCC(C)(C)CO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H66O9Si/c1-23(30(40-12)20-31(26(4)29(39-11)17-18-36)44-45(13,14)34(6,7)8)15-16-28(38)25(3)33(43-27(5)37)24(2)19-32-41-21-35(9,10)22-42-32/h18,23-26,29-33H,15-17,19-22H2,1-14H3/t23-,24+,25-,26+,29-,30-,31-,33+/m0/s1 |
| InChIKey | JOUHGRMWWHSLMB-MFAPJVLHSA-N |
| XLogP | 7.00 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.99 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|