C23H42O8Si — CID 56590398
methyl (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-methoxy-5,5-dimethyl-6-(2-oxoethyl)oxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate (PubChem CID 56590398) has the molecular formula C23H42O8Si and a molecular weight of 474.67 g/mol. Its IUPAC name is methyl (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-methoxy-5,5-dimethyl-6-(2-oxoethyl)oxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate.
| Compound Name | methyl (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-methoxy-5,5-dimethyl-6-(2-oxoethyl)oxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
|---|---|
| PubChem CID | 56590398 |
| Molecular Formula | C23H42O8Si |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | methyl (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-methoxy-5,5-dimethyl-6-(2-oxoethyl)oxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
| SMILES | COC(=O)C[C@@H](C[C@@H]1C[C@H](OC(C)=O)C(C)(C)[C@@](CC=O)(OC)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O8Si/c1-16(25)29-19-14-17(30-23(28-8,11-12-24)22(19,5)6)13-18(15-20(26)27-7)31-32(9,10)21(2,3)4/h12,17-19H,11,13-15H2,1-10H3/t17-,18-,19+,23+/m1/s1 |
| InChIKey | RRQNOHRBUWRRFI-GBPOLFSSSA-N |
| XLogP | 4.01 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|