C19H38O4Si — CID 102522910
1-[(2R,4S,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]propan-2-one (PubChem CID 102522910) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is 1-[(2R,4S,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]propan-2-one.
| Compound Name | 1-[(2R,4S,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 102522910 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1-[(2R,4S,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]propan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@](CC(C)=O)(OC)O[C@H](C(C)C)[C@H]1C |
| InChI | InChI=1S/C19H38O4Si/c1-9-24(10-2,11-3)23-17-13-19(21-8,12-15(6)20)22-18(14(4)5)16(17)7/h14,16-18H,9-13H2,1-8H3/t16-,17-,18+,19-/m0/s1 |
| InChIKey | RUZPENHRMKSCBC-OKYOBFRVSA-N |
| XLogP | 4.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|