C28H58O5Si2 — CID 134953250
(2R,3R,4R,5R,6R)-6-[(2S,3S,6S)-6-methoxy-3-methyloxan-2-yl]-2,4-dimethyl-3,5-bis(triethylsilyloxy)heptanal (PubChem CID 134953250) has the molecular formula C28H58O5Si2 and a molecular weight of 530.94 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-6-[(2S,3S,6S)-6-methoxy-3-methyloxan-2-yl]-2,4-dimethyl-3,5-bis(triethylsilyloxy)heptanal.
| Compound Name | (2R,3R,4R,5R,6R)-6-[(2S,3S,6S)-6-methoxy-3-methyloxan-2-yl]-2,4-dimethyl-3,5-bis(triethylsilyloxy)heptanal |
|---|---|
| PubChem CID | 134953250 |
| Molecular Formula | C28H58O5Si2 |
| Molecular Weight | 530.94 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | (2R,3R,4R,5R,6R)-6-[(2S,3S,6S)-6-methoxy-3-methyloxan-2-yl]-2,4-dimethyl-3,5-bis(triethylsilyloxy)heptanal |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C=O)[C@H](C)[C@H]1O[C@H](OC)CC[C@@H]1C |
| InChI | InChI=1S/C28H58O5Si2/c1-12-34(13-2,14-3)32-27(22(8)20-29)24(10)28(33-35(15-4,16-5)17-6)23(9)26-21(7)18-19-25(30-11)31-26/h20-28H,12-19H2,1-11H3/t21-,22-,23+,24-,25-,26-,27-,28+/m0/s1 |
| InChIKey | HUTBTFCMSKVJBD-MRPYZOCESA-N |
| XLogP | 7.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.94 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|