C26H52O5Si — CID 11248466
(3S,4S,6S,8R,10S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undecanoic acid (PubChem CID 11248466) has the molecular formula C26H52O5Si and a molecular weight of 472.78 g/mol. Its IUPAC name is (3S,4S,6S,8R,10S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undecanoic acid.
| Compound Name | (3S,4S,6S,8R,10S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undecanoic acid |
|---|---|
| PubChem CID | 11248466 |
| Molecular Formula | C26H52O5Si |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | (3S,4S,6S,8R,10S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undecanoic acid |
| SMILES | C[C@@H](C[C@H](C)COC1CCCCO1)C[C@H](C)C[C@H](C)[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O5Si/c1-19(15-21(3)18-30-25-12-10-11-13-29-25)14-20(2)16-22(4)23(17-24(27)28)31-32(8,9)26(5,6)7/h19-23,25H,10-18H2,1-9H3,(H,27,28)/t19-,20+,21+,22+,23+,25?/m1/s1 |
| InChIKey | MDHRLVSOFOYWLU-RSDYLRCWSA-N |
| XLogP | 7.11 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|