C28H52O9Si — CID 24862302
2-[(2S,3S,4S,6S)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2R)-2-methylcyclopropyl]ethyl]-3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetic acid (PubChem CID 24862302) has the molecular formula C28H52O9Si and a molecular weight of 560.80 g/mol. Its IUPAC name is 2-[(2S,3S,4S,6S)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2R)-2-methylcyclopropyl]ethyl]-3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetic acid.
| Compound Name | 2-[(2S,3S,4S,6S)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2R)-2-methylcyclopropyl]ethyl]-3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 24862302 |
| Molecular Formula | C28H52O9Si |
| Molecular Weight | 560.80 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 2-[(2S,3S,4S,6S)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2R)-2-methylcyclopropyl]ethyl]-3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetic acid |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](O[C@H]2C[C@@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3C[C@H]3C)O[C@@H](CC(=O)O)[C@@H]2C)OC[C@H]1OC |
| InChI | InChI=1S/C28H52O9Si/c1-16-11-19(16)22(37-38(9,10)28(3,4)5)13-18-12-20(17(2)21(35-18)14-24(29)30)36-27-26(33-8)25(32-7)23(31-6)15-34-27/h16-23,25-27H,11-15H2,1-10H3,(H,29,30)/t16-,17-,18+,19-,20+,21+,22+,23-,25+,26-,27+/m1/s1 |
| InChIKey | OYPLDHPDXNJNHS-AMKAGXHNSA-N |
| XLogP | 4.48 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.80 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|