C25H46O6Si2 — CID 59897760
[3-methyl-2,3-bis(trimethylsilyl)butan-2-yl] 2-methyl-2-[4-(2-methyloxolan-3-yl)-2,5-dioxooxolan-3-yl]butanoate (PubChem CID 59897760) has the molecular formula C25H46O6Si2 and a molecular weight of 498.81 g/mol. Its IUPAC name is [3-methyl-2,3-bis(trimethylsilyl)butan-2-yl] 2-methyl-2-[4-(2-methyloxolan-3-yl)-2,5-dioxooxolan-3-yl]butanoate.
| Compound Name | [3-methyl-2,3-bis(trimethylsilyl)butan-2-yl] 2-methyl-2-[4-(2-methyloxolan-3-yl)-2,5-dioxooxolan-3-yl]butanoate |
|---|---|
| PubChem CID | 59897760 |
| Molecular Formula | C25H46O6Si2 |
| Molecular Weight | 498.81 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [3-methyl-2,3-bis(trimethylsilyl)butan-2-yl] 2-methyl-2-[4-(2-methyloxolan-3-yl)-2,5-dioxooxolan-3-yl]butanoate |
| SMILES | CCC(C)(C(=O)OC(C)(C(C)(C)[Si](C)(C)C)[Si](C)(C)C)C1C(=O)OC(=O)C1C1CCOC1C |
| InChI | InChI=1S/C25H46O6Si2/c1-13-24(5,19-18(20(26)30-21(19)27)17-14-15-29-16(17)2)22(28)31-25(6,33(10,11)12)23(3,4)32(7,8)9/h16-19H,13-15H2,1-12H3 |
| InChIKey | AJQVBQJBFZNLKF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.81 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|