C32H52O11Si — CID 59089636
5-O-tert-butyl 1-O-(2-ethoxyethyl) 2,4-dimethyl-4-[[(4R)-4-methyl-2,5-dioxooxolan-3-yl]methyl]-2-[2-[(4R)-4-methyl-2,5-dioxooxolan-3-yl]-3-trimethylsilylpropyl]pentanedioate (PubChem CID 59089636) has the molecular formula C32H52O11Si and a molecular weight of 640.84 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-(2-ethoxyethyl) 2,4-dimethyl-4-[[(4R)-4-methyl-2,5-dioxooxolan-3-yl]methyl]-2-[2-[(4R)-4-methyl-2,5-dioxooxolan-3-yl]-3-trimethylsilylpropyl]pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-(2-ethoxyethyl) 2,4-dimethyl-4-[[(4R)-4-methyl-2,5-dioxooxolan-3-yl]methyl]-2-[2-[(4R)-4-methyl-2,5-dioxooxolan-3-yl]-3-trimethylsilylpropyl]pentanedioate |
|---|---|
| PubChem CID | 59089636 |
| Molecular Formula | C32H52O11Si |
| Molecular Weight | 640.84 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | 5-O-tert-butyl 1-O-(2-ethoxyethyl) 2,4-dimethyl-4-[[(4R)-4-methyl-2,5-dioxooxolan-3-yl]methyl]-2-[2-[(4R)-4-methyl-2,5-dioxooxolan-3-yl]-3-trimethylsilylpropyl]pentanedioate |
| SMILES | CCOCCOC(=O)C(C)(CC(C[Si](C)(C)C)C1C(=O)OC(=O)[C@@H]1C)CC(C)(CC1C(=O)OC(=O)[C@@H]1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H52O11Si/c1-12-39-13-14-40-28(37)31(7,15-21(17-44(9,10)11)23-20(3)25(34)42-27(23)36)18-32(8,29(38)43-30(4,5)6)16-22-19(2)24(33)41-26(22)35/h19-23H,12-18H2,1-11H3/t19-,20-,21?,22?,23?,31?,32?/m1/s1 |
| InChIKey | NSBFUKIKUUMSIJ-WQUFBGCRSA-N |
| XLogP | 4.72 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.84 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|