C18H38O4Si2 — CID 14436003
dimethyl 2-(3-methylbutyl)-2,4-bis(trimethylsilyl)pentanedioate (PubChem CID 14436003) has the molecular formula C18H38O4Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is dimethyl 2-(3-methylbutyl)-2,4-bis(trimethylsilyl)pentanedioate.
| Compound Name | dimethyl 2-(3-methylbutyl)-2,4-bis(trimethylsilyl)pentanedioate |
|---|---|
| PubChem CID | 14436003 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | dimethyl 2-(3-methylbutyl)-2,4-bis(trimethylsilyl)pentanedioate |
| SMILES | COC(=O)C(CC(CCC(C)C)(C(=O)OC)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H38O4Si2/c1-14(2)11-12-18(17(20)22-4,24(8,9)10)13-15(16(19)21-3)23(5,6)7/h14-15H,11-13H2,1-10H3 |
| InChIKey | NBVHOZSYOILCEN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|