C17H36O4Si2 — CID 14436005
dimethyl 2-(2-methylpropyl)-2,4-bis(trimethylsilyl)pentanedioate (PubChem CID 14436005) has the molecular formula C17H36O4Si2 and a molecular weight of 360.64 g/mol. Its IUPAC name is dimethyl 2-(2-methylpropyl)-2,4-bis(trimethylsilyl)pentanedioate.
| Compound Name | dimethyl 2-(2-methylpropyl)-2,4-bis(trimethylsilyl)pentanedioate |
|---|---|
| PubChem CID | 14436005 |
| Molecular Formula | C17H36O4Si2 |
| Molecular Weight | 360.64 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | dimethyl 2-(2-methylpropyl)-2,4-bis(trimethylsilyl)pentanedioate |
| SMILES | COC(=O)C(CC(CC(C)C)(C(=O)OC)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H36O4Si2/c1-13(2)11-17(16(19)21-4,23(8,9)10)12-14(15(18)20-3)22(5,6)7/h13-14H,11-12H2,1-10H3 |
| InChIKey | IGWMRKTUWFQWOU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|