C15H32O4Si2 — CID 14435995
dimethyl 2-ethyl-2,4-bis(trimethylsilyl)pentanedioate (PubChem CID 14435995) has the molecular formula C15H32O4Si2 and a molecular weight of 332.59 g/mol. Its IUPAC name is dimethyl 2-ethyl-2,4-bis(trimethylsilyl)pentanedioate.
| Compound Name | dimethyl 2-ethyl-2,4-bis(trimethylsilyl)pentanedioate |
|---|---|
| PubChem CID | 14435995 |
| Molecular Formula | C15H32O4Si2 |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | dimethyl 2-ethyl-2,4-bis(trimethylsilyl)pentanedioate |
| SMILES | CCC(CC(C(=O)OC)[Si](C)(C)C)(C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C15H32O4Si2/c1-10-15(14(17)19-3,21(7,8)9)11-12(13(16)18-2)20(4,5)6/h12H,10-11H2,1-9H3 |
| InChIKey | JFQRZCBZNUOWDF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|