C19H40O4Si3 — CID 10598027
dimethyl 2,4-bis(trimethylsilyl)-2-(2-trimethylsilylprop-2-enyl)pentanedioate (PubChem CID 10598027) has the molecular formula C19H40O4Si3 and a molecular weight of 416.78 g/mol. Its IUPAC name is dimethyl 2,4-bis(trimethylsilyl)-2-(2-trimethylsilylprop-2-enyl)pentanedioate.
| Compound Name | dimethyl 2,4-bis(trimethylsilyl)-2-(2-trimethylsilylprop-2-enyl)pentanedioate |
|---|---|
| PubChem CID | 10598027 |
| Molecular Formula | C19H40O4Si3 |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | dimethyl 2,4-bis(trimethylsilyl)-2-(2-trimethylsilylprop-2-enyl)pentanedioate |
| SMILES | C=C(CC(CC(C(=O)OC)[Si](C)(C)C)(C(=O)OC)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C19H40O4Si3/c1-15(24(4,5)6)13-19(18(21)23-3,26(10,11)12)14-16(17(20)22-2)25(7,8)9/h16H,1,13-14H2,2-12H3 |
| InChIKey | ORBCMILJXDURQV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|