C26H44O8Si — CID 59060990
1-O-tert-butyl 5-O-(3-oxobutan-2-yl) 4-methyl-2-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate (PubChem CID 59060990) has the molecular formula C26H44O8Si and a molecular weight of 512.72 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(3-oxobutan-2-yl) 4-methyl-2-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(3-oxobutan-2-yl) 4-methyl-2-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate |
|---|---|
| PubChem CID | 59060990 |
| Molecular Formula | C26H44O8Si |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 1-O-tert-butyl 5-O-(3-oxobutan-2-yl) 4-methyl-2-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate |
| SMILES | CC(=O)C(C)OC(=O)C(C)CC(CC1C(=O)OC(=O)C1CC(C)C[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H44O8Si/c1-15(14-35(8,9)10)11-20-21(25(31)33-24(20)30)13-19(23(29)34-26(5,6)7)12-16(2)22(28)32-18(4)17(3)27/h15-16,18-21H,11-14H2,1-10H3 |
| InChIKey | WTRNHIBCDBNJFX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|