C28H48O8Si — CID 59061005
5-O-tert-butyl 1-O-(2-methyl-4-oxopentan-2-yl) 2-methyl-4-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate (PubChem CID 59061005) has the molecular formula C28H48O8Si and a molecular weight of 540.77 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-(2-methyl-4-oxopentan-2-yl) 2-methyl-4-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-(2-methyl-4-oxopentan-2-yl) 2-methyl-4-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate |
|---|---|
| PubChem CID | 59061005 |
| Molecular Formula | C28H48O8Si |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 5-O-tert-butyl 1-O-(2-methyl-4-oxopentan-2-yl) 2-methyl-4-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate |
| SMILES | CC(=O)CC(C)(C)OC(=O)C(C)CC(CC1C(=O)OC(=O)C1CC(C)C[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H48O8Si/c1-17(16-37(9,10)11)12-21-22(26(33)34-25(21)32)14-20(24(31)35-27(4,5)6)13-18(2)23(30)36-28(7,8)15-19(3)29/h17-18,20-22H,12-16H2,1-11H3 |
| InChIKey | RXEYBJSBMXFRNU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|