C21H38O7 — CID 21133623
3-butan-2-yl-4-[3-hydroperoxy-2-(3-hydroperoxy-2-methylbutyl)-4,4-dimethylhexyl]oxolane-2,5-dione (PubChem CID 21133623) has the molecular formula C21H38O7 and a molecular weight of 402.53 g/mol. Its IUPAC name is 3-butan-2-yl-4-[3-hydroperoxy-2-(3-hydroperoxy-2-methylbutyl)-4,4-dimethylhexyl]oxolane-2,5-dione.
| Compound Name | 3-butan-2-yl-4-[3-hydroperoxy-2-(3-hydroperoxy-2-methylbutyl)-4,4-dimethylhexyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 21133623 |
| Molecular Formula | C21H38O7 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 3-butan-2-yl-4-[3-hydroperoxy-2-(3-hydroperoxy-2-methylbutyl)-4,4-dimethylhexyl]oxolane-2,5-dione |
| SMILES | CCC(C)C1C(=O)OC(=O)C1CC(CC(C)C(C)OO)C(OO)C(C)(C)CC |
| InChI | InChI=1S/C21H38O7/c1-8-12(3)17-16(19(22)26-20(17)23)11-15(10-13(4)14(5)27-24)18(28-25)21(6,7)9-2/h12-18,24-25H,8-11H2,1-7H3 |
| InChIKey | LFUCRABUSJXTPK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|