C31H54O7 — CID 21133618
3-[5-hydroperoxy-2-[hydroperoxy-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-4,6,6-trimethyloctyl]-4-pentan-3-yloxolane-2,5-dione (PubChem CID 21133618) has the molecular formula C31H54O7 and a molecular weight of 538.77 g/mol. Its IUPAC name is 3-[5-hydroperoxy-2-[hydroperoxy-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-4,6,6-trimethyloctyl]-4-pentan-3-yloxolane-2,5-dione.
| Compound Name | 3-[5-hydroperoxy-2-[hydroperoxy-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-4,6,6-trimethyloctyl]-4-pentan-3-yloxolane-2,5-dione |
|---|---|
| PubChem CID | 21133618 |
| Molecular Formula | C31H54O7 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.39 |
| IUPAC Name | 3-[5-hydroperoxy-2-[hydroperoxy-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-4,6,6-trimethyloctyl]-4-pentan-3-yloxolane-2,5-dione |
| SMILES | CCC(CC)C1C(=O)OC(=O)C1CC(CC(C)C(OO)C(C)(C)CC)C(OO)C1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C31H54O7/c1-10-19(11-2)24-22(27(32)36-28(24)33)16-20(15-18(4)26(38-35)29(5,6)12-3)25(37-34)23-17-21-13-14-31(23,9)30(21,7)8/h18-26,34-35H,10-17H2,1-9H3 |
| InChIKey | DHNKSCJLAKPNGU-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|