C21H28O9 — CID 20678190
dimethyl 5-[4-(1-methoxy-2-methyl-1-oxopropan-2-yl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 20678190) has the molecular formula C21H28O9 and a molecular weight of 424.45 g/mol. Its IUPAC name is dimethyl 5-[4-(1-methoxy-2-methyl-1-oxopropan-2-yl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | dimethyl 5-[4-(1-methoxy-2-methyl-1-oxopropan-2-yl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 20678190 |
| Molecular Formula | C21H28O9 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | dimethyl 5-[4-(1-methoxy-2-methyl-1-oxopropan-2-yl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | COC(=O)C1C2CC(C1C(=O)OC)C(C1C(=O)OC(=O)C1C(C)(C)C(=O)OC)C2C |
| InChI | InChI=1S/C21H28O9/c1-8-9-7-10(13(17(23)28-5)12(9)16(22)27-4)11(8)14-15(19(25)30-18(14)24)21(2,3)20(26)29-6/h8-15H,7H2,1-6H3 |
| InChIKey | FPEWBUGFOCKIOV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|