C16H22O8 — CID 14228082
tetramethyl 1-methylbicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate (PubChem CID 14228082) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is tetramethyl 1-methylbicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate.
| Compound Name | tetramethyl 1-methylbicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 14228082 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | tetramethyl 1-methylbicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate |
| SMILES | COC(=O)C1C2CC(C)(C1C(=O)OC)C(C(=O)OC)C2C(=O)OC |
| InChI | InChI=1S/C16H22O8/c1-16-6-7(8(12(17)21-2)10(16)14(19)23-4)9(13(18)22-3)11(16)15(20)24-5/h7-11H,6H2,1-5H3 |
| InChIKey | UDWFKHWXUQMFTM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|