C23H32O11 — CID 20675726
bis(methoxymethyl) 5-[4-(1-methoxy-2-methyl-1-oxopropan-2-yl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 20675726) has the molecular formula C23H32O11 and a molecular weight of 484.50 g/mol. Its IUPAC name is bis(methoxymethyl) 5-[4-(1-methoxy-2-methyl-1-oxopropan-2-yl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | bis(methoxymethyl) 5-[4-(1-methoxy-2-methyl-1-oxopropan-2-yl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 20675726 |
| Molecular Formula | C23H32O11 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | bis(methoxymethyl) 5-[4-(1-methoxy-2-methyl-1-oxopropan-2-yl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | COCOC(=O)C1C2CC(C1C(=O)OCOC)C(C1C(=O)OC(=O)C1C(C)(C)C(=O)OC)C2C |
| InChI | InChI=1S/C23H32O11/c1-10-11-7-12(15(19(25)33-9-30-5)14(11)18(24)32-8-29-4)13(10)16-17(21(27)34-20(16)26)23(2,3)22(28)31-6/h10-17H,7-9H2,1-6H3 |
| InChIKey | QRQRLYNDZGTSQP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|