C27H38O9 — CID 20675727
bis(methoxymethyl) 5-[4-(3,5-dimethyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 20675727) has the molecular formula C27H38O9 and a molecular weight of 506.59 g/mol. Its IUPAC name is bis(methoxymethyl) 5-[4-(3,5-dimethyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | bis(methoxymethyl) 5-[4-(3,5-dimethyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 20675727 |
| Molecular Formula | C27H38O9 |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | bis(methoxymethyl) 5-[4-(3,5-dimethyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | COCOC(=O)C1C2CC(C1C(=O)OCOC)C(C1C(=O)OC(=O)C1C1C3CC(C)C(C3)C1C)C2C |
| InChI | InChI=1S/C27H38O9/c1-11-6-14-7-15(11)12(2)18(14)22-23(27(31)36-26(22)30)19-13(3)16-8-17(19)21(25(29)35-10-33-5)20(16)24(28)34-9-32-4/h11-23H,6-10H2,1-5H3 |
| InChIKey | MYXRCMVMYCRMKU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|