C21H32O5 — CID 21302000
tert-butyl 2,2-dimethyl-3-[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]propanoate (PubChem CID 21302000) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-3-[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]propanoate.
| Compound Name | tert-butyl 2,2-dimethyl-3-[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]propanoate |
|---|---|
| PubChem CID | 21302000 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | tert-butyl 2,2-dimethyl-3-[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]propanoate |
| SMILES | CC1C2CCC(C2)C1C1C(=O)OC(=O)C1CC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32O5/c1-11-12-7-8-13(9-12)15(11)16-14(17(22)25-18(16)23)10-21(5,6)19(24)26-20(2,3)4/h11-16H,7-10H2,1-6H3 |
| InChIKey | NJGKWUXTUGPPEQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|