C23H30F6O6 — CID 59893056
methyl 3-[4-[2,3-dimethyl-6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate (PubChem CID 59893056) has the molecular formula C23H30F6O6 and a molecular weight of 516.48 g/mol. Its IUPAC name is methyl 3-[4-[2,3-dimethyl-6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[4-[2,3-dimethyl-6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59893056 |
| Molecular Formula | C23H30F6O6 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | methyl 3-[4-[2,3-dimethyl-6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)CC1C(=O)OC(=O)C1C1(C)C(C)C2CC(CC(O)(C(F)(F)F)C(F)(F)F)C1C2 |
| InChI | InChI=1S/C23H30F6O6/c1-10-11-6-12(8-21(33,22(24,25)26)23(27,28)29)14(7-11)20(10,4)15-13(16(30)35-17(15)31)9-19(2,3)18(32)34-5/h10-15,33H,6-9H2,1-5H3 |
| InChIKey | LDWLHFBROFGSEU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|