C16H32O4Si — CID 101383534
methyl (3R)-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]butanoate (PubChem CID 101383534) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is methyl (3R)-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]butanoate.
| Compound Name | methyl (3R)-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]butanoate |
|---|---|
| PubChem CID | 101383534 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | methyl (3R)-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]butanoate |
| SMILES | COC(=O)C[C@@H](C)[C@H]1OCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-12(11-14(17)18-5)15-13(9-8-10-19-15)20-21(6,7)16(2,3)4/h12-13,15H,8-11H2,1-7H3/t12-,13+,15-/m1/s1 |
| InChIKey | CUVMGUGDPICICA-VNHYZAJKSA-N |
| XLogP | 3.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|