C20H42O4Si2 — CID 44604624
(3R,5S)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-methyloxolan-2-one (PubChem CID 44604624) has the molecular formula C20H42O4Si2 and a molecular weight of 402.72 g/mol. Its IUPAC name is (3R,5S)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-methyloxolan-2-one.
| Compound Name | (3R,5S)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 44604624 |
| Molecular Formula | C20H42O4Si2 |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (3R,5S)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-methyloxolan-2-one |
| SMILES | C[C@@H]1C[C@@H]([C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C20H42O4Si2/c1-15-14-17(23-18(15)21)16(24-26(10,11)20(5,6)7)12-13-22-25(8,9)19(2,3)4/h15-17H,12-14H2,1-11H3/t15-,16+,17+/m1/s1 |
| InChIKey | DIQRKVSWADGYIS-IKGGRYGDSA-N |
| XLogP | 5.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|