C19H36O4Si — CID 11013732
(5S)-5-[(2R,5R,6S)-5-ethyl-6-methyl-5-triethylsilyloxyoxan-2-yl]-5-methyloxolan-2-one (PubChem CID 11013732) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is (5S)-5-[(2R,5R,6S)-5-ethyl-6-methyl-5-triethylsilyloxyoxan-2-yl]-5-methyloxolan-2-one.
| Compound Name | (5S)-5-[(2R,5R,6S)-5-ethyl-6-methyl-5-triethylsilyloxyoxan-2-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 11013732 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (5S)-5-[(2R,5R,6S)-5-ethyl-6-methyl-5-triethylsilyloxyoxan-2-yl]-5-methyloxolan-2-one |
| SMILES | CC[C@@]1(O[Si](CC)(CC)CC)CC[C@H]([C@]2(C)CCC(=O)O2)O[C@H]1C |
| InChI | InChI=1S/C19H36O4Si/c1-7-19(23-24(8-2,9-3)10-4)14-11-16(21-15(19)5)18(6)13-12-17(20)22-18/h15-16H,7-14H2,1-6H3/t15-,16+,18-,19+/m0/s1 |
| InChIKey | DWSWSCBOAHAEFO-OGWHTMIXSA-N |
| XLogP | 4.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|