C23H48O4Si2 — CID 134975017
(6R)-6-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-6-butyloxan-2-one (PubChem CID 134975017) has the molecular formula C23H48O4Si2 and a molecular weight of 444.81 g/mol. Its IUPAC name is (6R)-6-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-6-butyloxan-2-one.
| Compound Name | (6R)-6-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-6-butyloxan-2-one |
|---|---|
| PubChem CID | 134975017 |
| Molecular Formula | C23H48O4Si2 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | (6R)-6-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-6-butyloxan-2-one |
| SMILES | CCCC[C@]1([C@H](CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC)CCCC(=O)O1 |
| InChI | InChI=1S/C23H48O4Si2/c1-8-15-18-23(19-16-17-22(24)26-23)21(27-29(12-5,13-6)14-7)20-25-28(9-2,10-3)11-4/h21H,8-20H2,1-7H3/t21-,23+/m0/s1 |
| InChIKey | XWIRDDGQPSNYRR-JTHBVZDNSA-N |
| XLogP | 7.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|