C28H56O5Si2 — CID 134975077
ethyl 3-[(2R)-2-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-2-butyl-3,4-dihydropyran-6-yl]propanoate (PubChem CID 134975077) has the molecular formula C28H56O5Si2 and a molecular weight of 528.92 g/mol. Its IUPAC name is ethyl 3-[(2R)-2-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-2-butyl-3,4-dihydropyran-6-yl]propanoate.
| Compound Name | ethyl 3-[(2R)-2-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-2-butyl-3,4-dihydropyran-6-yl]propanoate |
|---|---|
| PubChem CID | 134975077 |
| Molecular Formula | C28H56O5Si2 |
| Molecular Weight | 528.92 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | ethyl 3-[(2R)-2-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-2-butyl-3,4-dihydropyran-6-yl]propanoate |
| SMILES | CCCC[C@]1([C@H](CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC)CCC=C(CCC(=O)OCC)O1 |
| InChI | InChI=1S/C28H56O5Si2/c1-9-17-22-28(23-18-19-25(32-28)20-21-27(29)30-10-2)26(33-35(14-6,15-7)16-8)24-31-34(11-3,12-4)13-5/h19,26H,9-18,20-24H2,1-8H3/t26-,28+/m0/s1 |
| InChIKey | XBBITZIWYSWDNL-XTEPFMGCSA-N |
| XLogP | 8.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.92 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|