C16H28N2O2S — CID 103486910
ethyl 3-[2-[pentyl(propan-2-yl)amino]-1,3-thiazol-4-yl]propanoate (PubChem CID 103486910) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is ethyl 3-[2-[pentyl(propan-2-yl)amino]-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-[pentyl(propan-2-yl)amino]-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103486910 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | ethyl 3-[2-[pentyl(propan-2-yl)amino]-1,3-thiazol-4-yl]propanoate |
| SMILES | CCCCCN(c1nc(CCC(=O)OCC)cs1)C(C)C |
| InChI | InChI=1S/C16H28N2O2S/c1-5-7-8-11-18(13(3)4)16-17-14(12-21-16)9-10-15(19)20-6-2/h12-13H,5-11H2,1-4H3 |
| InChIKey | MDRCLSDRUIBNQJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|