C18H24O4 — CID 134974934
(6R)-6-butyl-6-[(4S)-2-phenyl-1,3-dioxolan-4-yl]oxan-2-one (PubChem CID 134974934) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (6R)-6-butyl-6-[(4S)-2-phenyl-1,3-dioxolan-4-yl]oxan-2-one.
| Compound Name | (6R)-6-butyl-6-[(4S)-2-phenyl-1,3-dioxolan-4-yl]oxan-2-one |
|---|---|
| PubChem CID | 134974934 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (6R)-6-butyl-6-[(4S)-2-phenyl-1,3-dioxolan-4-yl]oxan-2-one |
| SMILES | CCCC[C@]1([C@@H]2COC(c3ccccc3)O2)CCCC(=O)O1 |
| InChI | InChI=1S/C18H24O4/c1-2-3-11-18(12-7-10-16(19)22-18)15-13-20-17(21-15)14-8-5-4-6-9-14/h4-6,8-9,15,17H,2-3,7,10-13H2,1H3/t15-,17?,18+/m0/s1 |
| InChIKey | DMXRVQJNVUHFMS-DKKDMOBXSA-N |
| XLogP | 3.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |