C20H32O3 — CID 15077847
5-decoxy-2-phenyl-1,3-dioxane (PubChem CID 15077847) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 5-decoxy-2-phenyl-1,3-dioxane.
| Compound Name | 5-decoxy-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 15077847 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 5-decoxy-2-phenyl-1,3-dioxane |
| SMILES | CCCCCCCCCCOC1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-12-15-21-19-16-22-20(23-17-19)18-13-10-9-11-14-18/h9-11,13-14,19-20H,2-8,12,15-17H2,1H3 |
| InChIKey | NCVBROIPVZPARB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|