C33H62O7Si — CID 134895334
(5S)-5-[(2R,5S)-5-ethyl-5-[(2R,3S,5R)-5-[(3S,5R,6R)-6-methoxy-6-(methoxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]oxolan-2-yl]-5-triethylsilyloxyhexan-2-one (PubChem CID 134895334) has the molecular formula C33H62O7Si and a molecular weight of 598.94 g/mol. Its IUPAC name is (5S)-5-[(2R,5S)-5-ethyl-5-[(2R,3S,5R)-5-[(3S,5R,6R)-6-methoxy-6-(methoxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]oxolan-2-yl]-5-triethylsilyloxyhexan-2-one.
| Compound Name | (5S)-5-[(2R,5S)-5-ethyl-5-[(2R,3S,5R)-5-[(3S,5R,6R)-6-methoxy-6-(methoxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]oxolan-2-yl]-5-triethylsilyloxyhexan-2-one |
|---|---|
| PubChem CID | 134895334 |
| Molecular Formula | C33H62O7Si |
| Molecular Weight | 598.94 g/mol |
| Exact Mass | 598.43 |
| IUPAC Name | (5S)-5-[(2R,5S)-5-ethyl-5-[(2R,3S,5R)-5-[(3S,5R,6R)-6-methoxy-6-(methoxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]oxolan-2-yl]-5-triethylsilyloxyhexan-2-one |
| SMILES | CC[C@@]1([C@@H]2O[C@@H](C3O[C@](COC)(OC)[C@H](C)C[C@@H]3C)C[C@@H]2C)CC[C@H]([C@](C)(CCC(C)=O)O[Si](CC)(CC)CC)O1 |
| InChI | InChI=1S/C33H62O7Si/c1-12-32(19-17-28(38-32)31(9,18-16-26(8)34)40-41(13-2,14-3)15-4)30-24(6)21-27(37-30)29-23(5)20-25(7)33(36-11,39-29)22-35-10/h23-25,27-30H,12-22H2,1-11H3/t23-,24-,25+,27+,28+,29?,30+,31-,32-,33-/m0/s1 |
| InChIKey | VUUHQTSIBCIGIT-GKUILWTCSA-N |
| XLogP | 7.31 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.94 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|