C34H70O5Si2 — CID 11072176
(2S,6R,8R,9R)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4R,5R)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]-2,6,10-trimethylundecan-4-one (PubChem CID 11072176) has the molecular formula C34H70O5Si2 and a molecular weight of 615.10 g/mol. Its IUPAC name is (2S,6R,8R,9R)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4R,5R)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]-2,6,10-trimethylundecan-4-one.
| Compound Name | (2S,6R,8R,9R)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4R,5R)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]-2,6,10-trimethylundecan-4-one |
|---|---|
| PubChem CID | 11072176 |
| Molecular Formula | C34H70O5Si2 |
| Molecular Weight | 615.10 g/mol |
| Exact Mass | 614.48 |
| IUPAC Name | (2S,6R,8R,9R)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4R,5R)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]-2,6,10-trimethylundecan-4-one |
| SMILES | CC(C)[C@H]1OC(C)(C)O[C@@H]1C[C@H](C)CC(=O)C[C@H](C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C34H70O5Si2/c1-23(2)30-28(36-34(13,14)37-30)21-25(5)19-27(35)20-26(6)22-29(38-40(15,16)32(7,8)9)31(24(3)4)39-41(17,18)33(10,11)12/h23-26,28-31H,19-22H2,1-18H3/t25-,26+,28-,29-,30-,31-/m1/s1 |
| InChIKey | XBRSSAPAKLFCDW-YJVJFABRSA-N |
| XLogP | 10.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.10 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|