C20H40O4Si — CID 14105470
2-[5-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-3-one (PubChem CID 14105470) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is 2-[5-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-3-one.
| Compound Name | 2-[5-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-3-one |
|---|---|
| PubChem CID | 14105470 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 2-[5-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-3-one |
| SMILES | CCC(=O)C(C)C1OC(C)(C)OC1(C)C(CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-12-15(21)14(3)17-20(9,24-19(7,8)22-17)16(13-2)23-25(10,11)18(4,5)6/h14,16-17H,12-13H2,1-11H3 |
| InChIKey | RNTPIUHADNCTHQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|