C23H38O7 — CID 71193970
(1R,2R,5R,7S,9S,11R,13R,14R)-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,15,17-trioxabicyclo[12.3.0]heptadecane-4,12,16-trione (PubChem CID 71193970) has the molecular formula C23H38O7 and a molecular weight of 426.55 g/mol. Its IUPAC name is (1R,2R,5R,7S,9S,11R,13R,14R)-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,15,17-trioxabicyclo[12.3.0]heptadecane-4,12,16-trione.
| Compound Name | (1R,2R,5R,7S,9S,11R,13R,14R)-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,15,17-trioxabicyclo[12.3.0]heptadecane-4,12,16-trione |
|---|---|
| PubChem CID | 71193970 |
| Molecular Formula | C23H38O7 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (1R,2R,5R,7S,9S,11R,13R,14R)-2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-3,15,17-trioxabicyclo[12.3.0]heptadecane-4,12,16-trione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C[C@H](C)C[C@](C)(OC)C[C@@H](C)C(=O)[C@H](C)[C@H]2OC(=O)O[C@@]21C |
| InChI | InChI=1S/C23H38O7/c1-9-17-23(7)19(29-21(26)30-23)16(5)18(24)15(4)12-22(6,27-8)11-13(2)10-14(3)20(25)28-17/h13-17,19H,9-12H2,1-8H3/t13-,14+,15+,16-,17+,19+,22-,23+/m0/s1 |
| InChIKey | YAJFUGOGSCCAJM-LPYYHRRWSA-N |
| XLogP | 4.30 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |