C15H28O5 — CID 102211461
(4S,5R,6S)-6-(2-ethyl-1,3-dioxolan-2-yl)-5-(methoxymethoxy)-4-methylheptan-3-one (PubChem CID 102211461) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is (4S,5R,6S)-6-(2-ethyl-1,3-dioxolan-2-yl)-5-(methoxymethoxy)-4-methylheptan-3-one.
| Compound Name | (4S,5R,6S)-6-(2-ethyl-1,3-dioxolan-2-yl)-5-(methoxymethoxy)-4-methylheptan-3-one |
|---|---|
| PubChem CID | 102211461 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (4S,5R,6S)-6-(2-ethyl-1,3-dioxolan-2-yl)-5-(methoxymethoxy)-4-methylheptan-3-one |
| SMILES | CCC(=O)[C@@H](C)[C@@H](OCOC)[C@H](C)C1(CC)OCCO1 |
| InChI | InChI=1S/C15H28O5/c1-6-13(16)11(3)14(18-10-17-5)12(4)15(7-2)19-8-9-20-15/h11-12,14H,6-10H2,1-5H3/t11-,12+,14-/m1/s1 |
| InChIKey | JPVHRGJWTZOXNY-MBNYWOFBSA-N |
| XLogP | 2.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|